C9H11NO2 — CID 130882471
3-hydroxy-4,5-dimethylbenzamide (PubChem CID 130882471) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-hydroxy-4,5-dimethylbenzamide.
| Compound Name | 3-hydroxy-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 130882471 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-hydroxy-4,5-dimethylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(O)c1C |
| InChI | InChI=1S/C9H11NO2/c1-5-3-7(9(10)12)4-8(11)6(5)2/h3-4,11H,1-2H3,(H2,10,12) |
| InChIKey | OUABPBJLHHIMHD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |