C7H5Cl3N2O — CID 57220184
2,2,2-trichloro-1-(2-methylpyrimidin-5-yl)ethanone (PubChem CID 57220184) has the molecular formula C7H5Cl3N2O and a molecular weight of 239.49 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(2-methylpyrimidin-5-yl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(2-methylpyrimidin-5-yl)ethanone |
|---|---|
| PubChem CID | 57220184 |
| Molecular Formula | C7H5Cl3N2O |
| Molecular Weight | 239.49 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | 2,2,2-trichloro-1-(2-methylpyrimidin-5-yl)ethanone |
| SMILES | Cc1ncc(C(=O)C(Cl)(Cl)Cl)cn1 |
| InChI | InChI=1S/C7H5Cl3N2O/c1-4-11-2-5(3-12-4)6(13)7(8,9)10/h2-3H,1H3 |
| InChIKey | NIMFLZCQFZPXEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|