C9H7Cl2FO — CID 130758399
2,2-dichloro-1-(3-fluoro-2-methylphenyl)ethanone (PubChem CID 130758399) has the molecular formula C9H7Cl2FO and a molecular weight of 221.06 g/mol. Its IUPAC name is 2,2-dichloro-1-(3-fluoro-2-methylphenyl)ethanone.
| Compound Name | 2,2-dichloro-1-(3-fluoro-2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 130758399 |
| Molecular Formula | C9H7Cl2FO |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 2,2-dichloro-1-(3-fluoro-2-methylphenyl)ethanone |
| SMILES | Cc1c(F)cccc1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C9H7Cl2FO/c1-5-6(8(13)9(10)11)3-2-4-7(5)12/h2-4,9H,1H3 |
| InChIKey | NEASJOUPNZNJGE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|