C13H11Cl2NO3 — CID 110273245
3-(2,2-dichloroacetyl)-4-hydroxy-1,6-dimethylquinolin-2-one (PubChem CID 110273245) has the molecular formula C13H11Cl2NO3 and a molecular weight of 300.14 g/mol. Its IUPAC name is 3-(2,2-dichloroacetyl)-4-hydroxy-1,6-dimethylquinolin-2-one.
| Compound Name | 3-(2,2-dichloroacetyl)-4-hydroxy-1,6-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 110273245 |
| Molecular Formula | C13H11Cl2NO3 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 3-(2,2-dichloroacetyl)-4-hydroxy-1,6-dimethylquinolin-2-one |
| SMILES | Cc1ccc2c(c1)c(O)c(C(=O)C(Cl)Cl)c(=O)n2C |
| InChI | InChI=1S/C13H11Cl2NO3/c1-6-3-4-8-7(5-6)10(17)9(11(18)12(14)15)13(19)16(8)2/h3-5,12,17H,1-2H3 |
| InChIKey | HIURVEFHNPBCHO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|