C12H8Cl2FNO3 — CID 110273241
3-(2,2-dichloroacetyl)-6-fluoro-4-hydroxy-1-methylquinolin-2-one (PubChem CID 110273241) has the molecular formula C12H8Cl2FNO3 and a molecular weight of 304.10 g/mol. Its IUPAC name is 3-(2,2-dichloroacetyl)-6-fluoro-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-(2,2-dichloroacetyl)-6-fluoro-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 110273241 |
| Molecular Formula | C12H8Cl2FNO3 |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 3-(2,2-dichloroacetyl)-6-fluoro-4-hydroxy-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(C(=O)C(Cl)Cl)c(O)c2cc(F)ccc21 |
| InChI | InChI=1S/C12H8Cl2FNO3/c1-16-7-3-2-5(15)4-6(7)9(17)8(12(16)19)10(18)11(13)14/h2-4,11,17H,1H3 |
| InChIKey | WPSYCZKTWGTRCJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|