C18H15FN2O3S — CID 123856404
N-(2-fluorophenyl)-4-hydroxy-1-methyl-6-methylsulfanyl-2-oxoquinoline-3-carboxamide (PubChem CID 123856404) has the molecular formula C18H15FN2O3S and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-hydroxy-1-methyl-6-methylsulfanyl-2-oxoquinoline-3-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-hydroxy-1-methyl-6-methylsulfanyl-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123856404 |
| Molecular Formula | C18H15FN2O3S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | N-(2-fluorophenyl)-4-hydroxy-1-methyl-6-methylsulfanyl-2-oxoquinoline-3-carboxamide |
| SMILES | CSc1ccc2c(c1)c(O)c(C(=O)Nc1ccccc1F)c(=O)n2C |
| InChI | InChI=1S/C18H15FN2O3S/c1-21-14-8-7-10(25-2)9-11(14)16(22)15(18(21)24)17(23)20-13-6-4-3-5-12(13)19/h3-9,22H,1-2H3,(H,20,23) |
| InChIKey | IOJLADNLHPMLFH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |