C23H26N2O4S — CID 139664827
4-hydroxy-1-methyl-6-methylsulfanyl-2-oxo-N-phenyl-N-(2-propoxyethyl)quinoline-3-carboxamide (PubChem CID 139664827) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-6-methylsulfanyl-2-oxo-N-phenyl-N-(2-propoxyethyl)quinoline-3-carboxamide.
| Compound Name | 4-hydroxy-1-methyl-6-methylsulfanyl-2-oxo-N-phenyl-N-(2-propoxyethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 139664827 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-hydroxy-1-methyl-6-methylsulfanyl-2-oxo-N-phenyl-N-(2-propoxyethyl)quinoline-3-carboxamide |
| SMILES | CCCOCCN(C(=O)c1c(O)c2cc(SC)ccc2n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-4-13-29-14-12-25(16-8-6-5-7-9-16)23(28)20-21(26)18-15-17(30-3)10-11-19(18)24(2)22(20)27/h5-11,15,26H,4,12-14H2,1-3H3 |
| InChIKey | RGOWSSKFAFWPQB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|