C21H21N3O5 — CID 139667758
ethyl N-[4-hydroxy-1-methyl-3-[methyl(phenyl)carbamoyl]-2-oxoquinolin-6-yl]carbamate (PubChem CID 139667758) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is ethyl N-[4-hydroxy-1-methyl-3-[methyl(phenyl)carbamoyl]-2-oxoquinolin-6-yl]carbamate.
| Compound Name | ethyl N-[4-hydroxy-1-methyl-3-[methyl(phenyl)carbamoyl]-2-oxoquinolin-6-yl]carbamate |
|---|---|
| PubChem CID | 139667758 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl N-[4-hydroxy-1-methyl-3-[methyl(phenyl)carbamoyl]-2-oxoquinolin-6-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)c(O)c(C(=O)N(C)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C21H21N3O5/c1-4-29-21(28)22-13-10-11-16-15(12-13)18(25)17(20(27)24(16)3)19(26)23(2)14-8-6-5-7-9-14/h5-12,25H,4H2,1-3H3,(H,22,28) |
| InChIKey | BRNHKIIVGMOSAH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |