C21H22N2O3Zn+2 — CID 54717328
zinc N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 54717328) has the molecular formula C21H22N2O3Zn+2 and a molecular weight of 415.81 g/mol. Its IUPAC name is zinc N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide.
| Compound Name | zinc N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54717328 |
| Molecular Formula | C21H22N2O3Zn+2 |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | zinc N,5-diethyl-4-hydroxy-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | CCc1cccc2c1c(O)c(C(=O)N(CC)c1ccccc1)c(=O)n2C.[Zn+2] |
| InChI | InChI=1S/C21H22N2O3.Zn/c1-4-14-10-9-13-16-17(14)19(24)18(20(25)22(16)3)21(26)23(5-2)15-11-7-6-8-12-15;/h6-13,24H,4-5H2,1-3H3;/q;+2 |
| InChIKey | SUZNUQMJCXSWMH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|