C19H16ClN5O3 — CID 91314834
N-(4-azidophenyl)-5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxamide (PubChem CID 91314834) has the molecular formula C19H16ClN5O3 and a molecular weight of 397.82 g/mol. Its IUPAC name is N-(4-azidophenyl)-5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxamide.
| Compound Name | N-(4-azidophenyl)-5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 91314834 |
| Molecular Formula | C19H16ClN5O3 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(4-azidophenyl)-5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxoquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1c(O)c2c(Cl)cccc2n(C)c1=O)c1ccc(N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C19H16ClN5O3/c1-3-25(12-9-7-11(8-10-12)22-23-21)19(28)16-17(26)15-13(20)5-4-6-14(15)24(2)18(16)27/h4-10,26H,3H2,1-2H3 |
| InChIKey | FAUAHUXIIQSECW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|