C28H33ClN2O5 — CID 130218197
[5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethyl 2-propylpentanoate (PubChem CID 130218197) has the molecular formula C28H33ClN2O5 and a molecular weight of 513.03 g/mol. Its IUPAC name is [5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethyl 2-propylpentanoate.
| Compound Name | [5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethyl 2-propylpentanoate |
|---|---|
| PubChem CID | 130218197 |
| Molecular Formula | C28H33ClN2O5 |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | [5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCOc1c(C(=O)N(CC)c2ccccc2)c(=O)n(C)c2cccc(Cl)c12 |
| InChI | InChI=1S/C28H33ClN2O5/c1-5-12-19(13-6-2)28(34)36-18-35-25-23-21(29)16-11-17-22(23)30(4)26(32)24(25)27(33)31(7-3)20-14-9-8-10-15-20/h8-11,14-17,19H,5-7,12-13,18H2,1-4H3 |
| InChIKey | JSTUOWRGYLPDGD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|