C32H39ClN6O8 — CID 130218024
2-amino-6-[[4-[[5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethoxycarbonyl]piperazine-1-carbonyl]amino]hexanoic acid (PubChem CID 130218024) has the molecular formula C32H39ClN6O8 and a molecular weight of 671.15 g/mol. Its IUPAC name is 2-amino-6-[[4-[[5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethoxycarbonyl]piperazine-1-carbonyl]amino]hexanoic acid.
| Compound Name | 2-amino-6-[[4-[[5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethoxycarbonyl]piperazine-1-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 130218024 |
| Molecular Formula | C32H39ClN6O8 |
| Molecular Weight | 671.15 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | 2-amino-6-[[4-[[5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl]oxymethoxycarbonyl]piperazine-1-carbonyl]amino]hexanoic acid |
| SMILES | CCN(C(=O)c1c(OCOC(=O)N2CCN(C(=O)NCCCCC(N)C(=O)O)CC2)c2c(Cl)cccc2n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C32H39ClN6O8/c1-3-39(21-10-5-4-6-11-21)29(41)26-27(25-22(33)12-9-14-24(25)36(2)28(26)40)46-20-47-32(45)38-18-16-37(17-19-38)31(44)35-15-8-7-13-23(34)30(42)43/h4-6,9-12,14,23H,3,7-8,13,15-20,34H2,1-2H3,(H,35,44)(H,42,43) |
| InChIKey | KCXWGQCVQQXHRA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 176.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|