C28H32ClN3O5 — CID 130218243
[5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl] 5-morpholin-4-ylpentanoate (PubChem CID 130218243) has the molecular formula C28H32ClN3O5 and a molecular weight of 526.03 g/mol. Its IUPAC name is [5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl] 5-morpholin-4-ylpentanoate.
| Compound Name | [5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl] 5-morpholin-4-ylpentanoate |
|---|---|
| PubChem CID | 130218243 |
| Molecular Formula | C28H32ClN3O5 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | [5-chloro-3-[ethyl(phenyl)carbamoyl]-1-methyl-2-oxoquinolin-4-yl] 5-morpholin-4-ylpentanoate |
| SMILES | CCN(C(=O)c1c(OC(=O)CCCCN2CCOCC2)c2c(Cl)cccc2n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C28H32ClN3O5/c1-3-32(20-10-5-4-6-11-20)28(35)25-26(24-21(29)12-9-13-22(24)30(2)27(25)34)37-23(33)14-7-8-15-31-16-18-36-19-17-31/h4-6,9-13H,3,7-8,14-19H2,1-2H3 |
| InChIKey | TYEOXRUMLIMIPJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|