C25H28ClN3O6 — CID 145349724
5-chloro-N-ethyl-4-[[hydroxy(morpholin-4-yl)methoxy]methoxy]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 145349724) has the molecular formula C25H28ClN3O6 and a molecular weight of 501.97 g/mol. Its IUPAC name is 5-chloro-N-ethyl-4-[[hydroxy(morpholin-4-yl)methoxy]methoxy]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide.
| Compound Name | 5-chloro-N-ethyl-4-[[hydroxy(morpholin-4-yl)methoxy]methoxy]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 145349724 |
| Molecular Formula | C25H28ClN3O6 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 5-chloro-N-ethyl-4-[[hydroxy(morpholin-4-yl)methoxy]methoxy]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | CCN(C(=O)c1c(OCOC(O)N2CCOCC2)c2c(Cl)cccc2n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C25H28ClN3O6/c1-3-29(17-8-5-4-6-9-17)24(31)21-22(34-16-35-25(32)28-12-14-33-15-13-28)20-18(26)10-7-11-19(20)27(2)23(21)30/h4-11,25,32H,3,12-16H2,1-2H3 |
| InChIKey | JHCWWKVWHKZCIV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|