C14H13Cl2NO3 — CID 110273242
3-(2,2-dichloroacetyl)-6-ethyl-4-hydroxy-1-methylquinolin-2-one (PubChem CID 110273242) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is 3-(2,2-dichloroacetyl)-6-ethyl-4-hydroxy-1-methylquinolin-2-one.
| Compound Name | 3-(2,2-dichloroacetyl)-6-ethyl-4-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 110273242 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-(2,2-dichloroacetyl)-6-ethyl-4-hydroxy-1-methylquinolin-2-one |
| SMILES | CCc1ccc2c(c1)c(O)c(C(=O)C(Cl)Cl)c(=O)n2C |
| InChI | InChI=1S/C14H13Cl2NO3/c1-3-7-4-5-9-8(6-7)11(18)10(12(19)13(15)16)14(20)17(9)2/h4-6,13,18H,3H2,1-2H3 |
| InChIKey | IYVBTNFSIFUZMJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|