C20H24I2O6 — CID 20758552
1-iodo-5-(5-iodo-2,3,4-trimethoxy-6-methylphenyl)-2,3,4-trimethoxy-6-methylbenzene (PubChem CID 20758552) has the molecular formula C20H24I2O6 and a molecular weight of 614.21 g/mol. Its IUPAC name is 1-iodo-5-(5-iodo-2,3,4-trimethoxy-6-methylphenyl)-2,3,4-trimethoxy-6-methylbenzene.
| Compound Name | 1-iodo-5-(5-iodo-2,3,4-trimethoxy-6-methylphenyl)-2,3,4-trimethoxy-6-methylbenzene |
|---|---|
| PubChem CID | 20758552 |
| Molecular Formula | C20H24I2O6 |
| Molecular Weight | 614.21 g/mol |
| Exact Mass | 613.97 |
| IUPAC Name | 1-iodo-5-(5-iodo-2,3,4-trimethoxy-6-methylphenyl)-2,3,4-trimethoxy-6-methylbenzene |
| SMILES | COc1c(I)c(C)c(-c2c(C)c(I)c(OC)c(OC)c2OC)c(OC)c1OC |
| InChI | InChI=1S/C20H24I2O6/c1-9-11(15(23-3)19(27-7)17(25-5)13(9)21)12-10(2)14(22)18(26-6)20(28-8)16(12)24-4/h1-8H3 |
| InChIKey | IMNWOJVZSWCONW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.21 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|