C11H13Cl2F — CID 177005609
1,4-dichloro-5-ethyl-3-fluoro-2-propan-2-ylbenzene (PubChem CID 177005609) has the molecular formula C11H13Cl2F and a molecular weight of 235.13 g/mol. Its IUPAC name is 1,4-dichloro-5-ethyl-3-fluoro-2-propan-2-ylbenzene.
| Compound Name | 1,4-dichloro-5-ethyl-3-fluoro-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 177005609 |
| Molecular Formula | C11H13Cl2F |
| Molecular Weight | 235.13 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 1,4-dichloro-5-ethyl-3-fluoro-2-propan-2-ylbenzene |
| SMILES | CCc1cc(Cl)c(C(C)C)c(F)c1Cl |
| InChI | InChI=1S/C11H13Cl2F/c1-4-7-5-8(12)9(6(2)3)11(14)10(7)13/h5-6H,4H2,1-3H3 |
| InChIKey | OGHVSDAWGHTOAJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.13 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|