C6H3Cl3FN — CID 155973401
2,4,6-trichloro-3-fluoroaniline (PubChem CID 155973401) has the molecular formula C6H3Cl3FN and a molecular weight of 214.45 g/mol. Its IUPAC name is 2,4,6-trichloro-3-fluoroaniline.
| Compound Name | 2,4,6-trichloro-3-fluoroaniline |
|---|---|
| PubChem CID | 155973401 |
| Molecular Formula | C6H3Cl3FN |
| Molecular Weight | 214.45 g/mol |
| Exact Mass | 212.93 |
| IUPAC Name | 2,4,6-trichloro-3-fluoroaniline |
| SMILES | Nc1c(Cl)cc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C6H3Cl3FN/c7-2-1-3(8)6(11)4(9)5(2)10/h1H,11H2 |
| InChIKey | SFVGJHLZECLVCD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|