C6H5Cl2FN2 — CID 12029505
2,4-dichloro-5-fluorobenzene-1,3-diamine (PubChem CID 12029505) has the molecular formula C6H5Cl2FN2 and a molecular weight of 195.02 g/mol. Its IUPAC name is 2,4-dichloro-5-fluorobenzene-1,3-diamine.
| Compound Name | 2,4-dichloro-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 12029505 |
| Molecular Formula | C6H5Cl2FN2 |
| Molecular Weight | 195.02 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 2,4-dichloro-5-fluorobenzene-1,3-diamine |
| SMILES | Nc1cc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C6H5Cl2FN2/c7-4-2(9)1-3(10)5(8)6(4)11/h1H,10-11H2 |
| InChIKey | IAFXRJJLJNJQQB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.02 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|