C10H12Cl2FN — CID 176800668
3-tert-butyl-2,4-dichloro-5-fluoroaniline (PubChem CID 176800668) has the molecular formula C10H12Cl2FN and a molecular weight of 236.12 g/mol. Its IUPAC name is 3-tert-butyl-2,4-dichloro-5-fluoroaniline.
| Compound Name | 3-tert-butyl-2,4-dichloro-5-fluoroaniline |
|---|---|
| PubChem CID | 176800668 |
| Molecular Formula | C10H12Cl2FN |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 3-tert-butyl-2,4-dichloro-5-fluoroaniline |
| SMILES | CC(C)(C)c1c(Cl)c(N)cc(F)c1Cl |
| InChI | InChI=1S/C10H12Cl2FN/c1-10(2,3)7-8(11)5(13)4-6(14)9(7)12/h4H,14H2,1-3H3 |
| InChIKey | PLFQEHBADSUOKI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|