C10H12ClF2N — CID 117313615
1-(2-chloro-3,5-difluorophenyl)-2-methylpropan-2-amine (PubChem CID 117313615) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is 1-(2-chloro-3,5-difluorophenyl)-2-methylpropan-2-amine.
| Compound Name | 1-(2-chloro-3,5-difluorophenyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 117313615 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-(2-chloro-3,5-difluorophenyl)-2-methylpropan-2-amine |
| SMILES | CC(C)(N)Cc1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C10H12ClF2N/c1-10(2,14)5-6-3-7(12)4-8(13)9(6)11/h3-4H,5,14H2,1-2H3 |
| InChIKey | DCDNZXGPCMUVBY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|