C8H7ClF2O — CID 117283325
2-(2-chloro-3,5-difluorophenyl)ethanol (PubChem CID 117283325) has the molecular formula C8H7ClF2O and a molecular weight of 192.59 g/mol. Its IUPAC name is 2-(2-chloro-3,5-difluorophenyl)ethanol.
| Compound Name | 2-(2-chloro-3,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 117283325 |
| Molecular Formula | C8H7ClF2O |
| Molecular Weight | 192.59 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 2-(2-chloro-3,5-difluorophenyl)ethanol |
| SMILES | OCCc1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C8H7ClF2O/c9-8-5(1-2-12)3-6(10)4-7(8)11/h3-4,12H,1-2H2 |
| InChIKey | QTHUBEMCXNJYAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|