C12H15ClF2N2 — CID 117406196
1-[2-(2-chloro-3,5-difluorophenyl)ethyl]piperazine (PubChem CID 117406196) has the molecular formula C12H15ClF2N2 and a molecular weight of 260.71 g/mol. Its IUPAC name is 1-[2-(2-chloro-3,5-difluorophenyl)ethyl]piperazine.
| Compound Name | 1-[2-(2-chloro-3,5-difluorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 117406196 |
| Molecular Formula | C12H15ClF2N2 |
| Molecular Weight | 260.71 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-[2-(2-chloro-3,5-difluorophenyl)ethyl]piperazine |
| SMILES | Fc1cc(F)c(Cl)c(CCN2CCNCC2)c1 |
| InChI | InChI=1S/C12H15ClF2N2/c13-12-9(7-10(14)8-11(12)15)1-4-17-5-2-16-3-6-17/h7-8,16H,1-6H2 |
| InChIKey | XQWZCXPHMYWTLI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|