C8H6F4O — CID 55267980
2-(2,3,4,5-tetrafluorophenyl)ethanol (PubChem CID 55267980) has the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. Its IUPAC name is 2-(2,3,4,5-tetrafluorophenyl)ethanol.
| Compound Name | 2-(2,3,4,5-tetrafluorophenyl)ethanol |
|---|---|
| PubChem CID | 55267980 |
| Molecular Formula | C8H6F4O |
| Molecular Weight | 194.13 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 2-(2,3,4,5-tetrafluorophenyl)ethanol |
| SMILES | OCCc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H6F4O/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3,13H,1-2H2 |
| InChIKey | YMIWADOBILQDJP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|