C13H18F4O3Si — CID 90175405
dihydroxy-methoxy-[6-(2,3,4,5-tetrafluorophenyl)hexyl]silane (PubChem CID 90175405) has the molecular formula C13H18F4O3Si and a molecular weight of 326.36 g/mol. Its IUPAC name is dihydroxy-methoxy-[6-(2,3,4,5-tetrafluorophenyl)hexyl]silane.
| Compound Name | dihydroxy-methoxy-[6-(2,3,4,5-tetrafluorophenyl)hexyl]silane |
|---|---|
| PubChem CID | 90175405 |
| Molecular Formula | C13H18F4O3Si |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | dihydroxy-methoxy-[6-(2,3,4,5-tetrafluorophenyl)hexyl]silane |
| SMILES | CO[Si](O)(O)CCCCCCc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H18F4O3Si/c1-20-21(18,19)7-5-3-2-4-6-9-8-10(14)12(16)13(17)11(9)15/h8,18-19H,2-7H2,1H3 |
| InChIKey | OAZLZOSIYZHIKE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|