C13H18F4O2Si — CID 90171977
dimethoxy-methyl-[4-(2,3,4,5-tetrafluorophenyl)butyl]silane (PubChem CID 90171977) has the molecular formula C13H18F4O2Si and a molecular weight of 310.36 g/mol. Its IUPAC name is dimethoxy-methyl-[4-(2,3,4,5-tetrafluorophenyl)butyl]silane.
| Compound Name | dimethoxy-methyl-[4-(2,3,4,5-tetrafluorophenyl)butyl]silane |
|---|---|
| PubChem CID | 90171977 |
| Molecular Formula | C13H18F4O2Si |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | dimethoxy-methyl-[4-(2,3,4,5-tetrafluorophenyl)butyl]silane |
| SMILES | CO[Si](C)(CCCCc1cc(F)c(F)c(F)c1F)OC |
| InChI | InChI=1S/C13H18F4O2Si/c1-18-20(3,19-2)7-5-4-6-9-8-10(14)12(16)13(17)11(9)15/h8H,4-7H2,1-3H3 |
| InChIKey | JDMDWSHDWGAPQK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|