C14H18F5NO4Si — CID 90174768
(2,3,4,5-tetrafluorophenyl) N-[4-[dimethoxy(methyl)silyl]butyl]-N-fluorocarbamate (PubChem CID 90174768) has the molecular formula C14H18F5NO4Si and a molecular weight of 387.38 g/mol. Its IUPAC name is (2,3,4,5-tetrafluorophenyl) N-[4-[dimethoxy(methyl)silyl]butyl]-N-fluorocarbamate.
| Compound Name | (2,3,4,5-tetrafluorophenyl) N-[4-[dimethoxy(methyl)silyl]butyl]-N-fluorocarbamate |
|---|---|
| PubChem CID | 90174768 |
| Molecular Formula | C14H18F5NO4Si |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | (2,3,4,5-tetrafluorophenyl) N-[4-[dimethoxy(methyl)silyl]butyl]-N-fluorocarbamate |
| SMILES | CO[Si](C)(CCCCN(F)C(=O)Oc1cc(F)c(F)c(F)c1F)OC |
| InChI | InChI=1S/C14H18F5NO4Si/c1-22-25(3,23-2)7-5-4-6-20(19)14(21)24-10-8-9(15)11(16)13(18)12(10)17/h8H,4-7H2,1-3H3 |
| InChIKey | ZUCQRLDTGZDBPT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|