C13H16F5NO4Si — CID 90170601
N,2,3,4,5-pentafluoro-N-(3-trimethoxysilylpropyl)benzamide (PubChem CID 90170601) has the molecular formula C13H16F5NO4Si and a molecular weight of 373.35 g/mol. Its IUPAC name is N,2,3,4,5-pentafluoro-N-(3-trimethoxysilylpropyl)benzamide.
| Compound Name | N,2,3,4,5-pentafluoro-N-(3-trimethoxysilylpropyl)benzamide |
|---|---|
| PubChem CID | 90170601 |
| Molecular Formula | C13H16F5NO4Si |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N,2,3,4,5-pentafluoro-N-(3-trimethoxysilylpropyl)benzamide |
| SMILES | CO[Si](CCCN(F)C(=O)c1cc(F)c(F)c(F)c1F)(OC)OC |
| InChI | InChI=1S/C13H16F5NO4Si/c1-21-24(22-2,23-3)6-4-5-19(18)13(20)8-7-9(14)11(16)12(17)10(8)15/h7H,4-6H2,1-3H3 |
| InChIKey | PTNHOZHBGDTWBO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|