C18H22F5NO6Si — CID 90172480
[3-(N,2,3,4,5-pentafluoroanilino)propyl-di(propanoyloxy)silyl] propanoate (PubChem CID 90172480) has the molecular formula C18H22F5NO6Si and a molecular weight of 471.45 g/mol. Its IUPAC name is [3-(N,2,3,4,5-pentafluoroanilino)propyl-di(propanoyloxy)silyl] propanoate.
| Compound Name | [3-(N,2,3,4,5-pentafluoroanilino)propyl-di(propanoyloxy)silyl] propanoate |
|---|---|
| PubChem CID | 90172480 |
| Molecular Formula | C18H22F5NO6Si |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [3-(N,2,3,4,5-pentafluoroanilino)propyl-di(propanoyloxy)silyl] propanoate |
| SMILES | CCC(=O)O[Si](CCCN(F)c1cc(F)c(F)c(F)c1F)(OC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C18H22F5NO6Si/c1-4-13(25)28-31(29-14(26)5-2,30-15(27)6-3)9-7-8-24(23)12-10-11(19)16(20)18(22)17(12)21/h10H,4-9H2,1-3H3 |
| InChIKey | WXEQSXNDQVHLNT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|