C17H21F3O6Si — CID 90170208
[di(propanoyloxy)-[2-(2,4,6-trifluorophenyl)ethyl]silyl] propanoate (PubChem CID 90170208) has the molecular formula C17H21F3O6Si and a molecular weight of 406.43 g/mol. Its IUPAC name is [di(propanoyloxy)-[2-(2,4,6-trifluorophenyl)ethyl]silyl] propanoate.
| Compound Name | [di(propanoyloxy)-[2-(2,4,6-trifluorophenyl)ethyl]silyl] propanoate |
|---|---|
| PubChem CID | 90170208 |
| Molecular Formula | C17H21F3O6Si |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [di(propanoyloxy)-[2-(2,4,6-trifluorophenyl)ethyl]silyl] propanoate |
| SMILES | CCC(=O)O[Si](CCc1c(F)cc(F)cc1F)(OC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C17H21F3O6Si/c1-4-15(21)24-27(25-16(22)5-2,26-17(23)6-3)8-7-12-13(19)9-11(18)10-14(12)20/h9-10H,4-8H2,1-3H3 |
| InChIKey | XZLRRYNGINUTEA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|