C18H21F5O7Si — CID 90172060
[3-(2,3,4,5,6-pentafluorophenoxy)propyl-di(propanoyloxy)silyl] propanoate (PubChem CID 90172060) has the molecular formula C18H21F5O7Si and a molecular weight of 472.44 g/mol. Its IUPAC name is [3-(2,3,4,5,6-pentafluorophenoxy)propyl-di(propanoyloxy)silyl] propanoate.
| Compound Name | [3-(2,3,4,5,6-pentafluorophenoxy)propyl-di(propanoyloxy)silyl] propanoate |
|---|---|
| PubChem CID | 90172060 |
| Molecular Formula | C18H21F5O7Si |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [3-(2,3,4,5,6-pentafluorophenoxy)propyl-di(propanoyloxy)silyl] propanoate |
| SMILES | CCC(=O)O[Si](CCCOc1c(F)c(F)c(F)c(F)c1F)(OC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C18H21F5O7Si/c1-4-10(24)28-31(29-11(25)5-2,30-12(26)6-3)9-7-8-27-18-16(22)14(20)13(19)15(21)17(18)23/h4-9H2,1-3H3 |
| InChIKey | GVCNDVPYQZYWEY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|