C15H15F5O6Si — CID 90170666
[(2,3,4,5,6-pentafluorophenyl)-di(propanoyloxy)silyl] propanoate (PubChem CID 90170666) has the molecular formula C15H15F5O6Si and a molecular weight of 414.36 g/mol. Its IUPAC name is [(2,3,4,5,6-pentafluorophenyl)-di(propanoyloxy)silyl] propanoate.
| Compound Name | [(2,3,4,5,6-pentafluorophenyl)-di(propanoyloxy)silyl] propanoate |
|---|---|
| PubChem CID | 90170666 |
| Molecular Formula | C15H15F5O6Si |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [(2,3,4,5,6-pentafluorophenyl)-di(propanoyloxy)silyl] propanoate |
| SMILES | CCC(=O)O[Si](OC(=O)CC)(OC(=O)CC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H15F5O6Si/c1-4-7(21)24-27(25-8(22)5-2,26-9(23)6-3)15-13(19)11(17)10(16)12(18)14(15)20/h4-6H2,1-3H3 |
| InChIKey | PQGMKPAHVXLMHD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|