C19H21F5O8Si — CID 90170959
3-tri(propanoyloxy)silylpropyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 90170959) has the molecular formula C19H21F5O8Si and a molecular weight of 500.45 g/mol. Its IUPAC name is 3-tri(propanoyloxy)silylpropyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | 3-tri(propanoyloxy)silylpropyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 90170959 |
| Molecular Formula | C19H21F5O8Si |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 3-tri(propanoyloxy)silylpropyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | CCC(=O)O[Si](CCCOC(=O)c1c(F)c(F)c(F)c(F)c1F)(OC(=O)CC)OC(=O)CC |
| InChI | InChI=1S/C19H21F5O8Si/c1-4-10(25)30-33(31-11(26)5-2,32-12(27)6-3)9-7-8-29-19(28)13-14(20)16(22)18(24)17(23)15(13)21/h4-9H2,1-3H3 |
| InChIKey | QLJJICOYZFKCOT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|