C20H31F5N2O4Si — CID 90170842
1,3-difluoro-1-(2,3,4-trifluorophenyl)-3-[4-tri(propan-2-yloxy)silylbutyl]urea (PubChem CID 90170842) has the molecular formula C20H31F5N2O4Si and a molecular weight of 486.55 g/mol. Its IUPAC name is 1,3-difluoro-1-(2,3,4-trifluorophenyl)-3-[4-tri(propan-2-yloxy)silylbutyl]urea.
| Compound Name | 1,3-difluoro-1-(2,3,4-trifluorophenyl)-3-[4-tri(propan-2-yloxy)silylbutyl]urea |
|---|---|
| PubChem CID | 90170842 |
| Molecular Formula | C20H31F5N2O4Si |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 1,3-difluoro-1-(2,3,4-trifluorophenyl)-3-[4-tri(propan-2-yloxy)silylbutyl]urea |
| SMILES | CC(C)O[Si](CCCCN(F)C(=O)N(F)c1ccc(F)c(F)c1F)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C20H31F5N2O4Si/c1-13(2)29-32(30-14(3)4,31-15(5)6)12-8-7-11-26(24)20(28)27(25)17-10-9-16(21)18(22)19(17)23/h9-10,13-15H,7-8,11-12H2,1-6H3 |
| InChIKey | QLYPUMAPGLPFKO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|