C14H19F5N2O4Si — CID 90170159
1-[3-[ethoxy(dimethoxy)silyl]propyl]-1,3-difluoro-3-(2,3,4-trifluorophenyl)urea (PubChem CID 90170159) has the molecular formula C14H19F5N2O4Si and a molecular weight of 402.39 g/mol. Its IUPAC name is 1-[3-[ethoxy(dimethoxy)silyl]propyl]-1,3-difluoro-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-[3-[ethoxy(dimethoxy)silyl]propyl]-1,3-difluoro-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 90170159 |
| Molecular Formula | C14H19F5N2O4Si |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-[3-[ethoxy(dimethoxy)silyl]propyl]-1,3-difluoro-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CCO[Si](CCCN(F)C(=O)N(F)c1ccc(F)c(F)c1F)(OC)OC |
| InChI | InChI=1S/C14H19F5N2O4Si/c1-4-25-26(23-2,24-3)9-5-8-20(18)14(22)21(19)11-7-6-10(15)12(16)13(11)17/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | ARILCXOCNSSKPK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|