C15H20F5NO3Si — CID 90170629
(2,3,4,5-tetrafluorophenyl) N-[3-[diethyl(methoxy)silyl]propyl]-N-fluorocarbamate (PubChem CID 90170629) has the molecular formula C15H20F5NO3Si and a molecular weight of 385.41 g/mol. Its IUPAC name is (2,3,4,5-tetrafluorophenyl) N-[3-[diethyl(methoxy)silyl]propyl]-N-fluorocarbamate.
| Compound Name | (2,3,4,5-tetrafluorophenyl) N-[3-[diethyl(methoxy)silyl]propyl]-N-fluorocarbamate |
|---|---|
| PubChem CID | 90170629 |
| Molecular Formula | C15H20F5NO3Si |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (2,3,4,5-tetrafluorophenyl) N-[3-[diethyl(methoxy)silyl]propyl]-N-fluorocarbamate |
| SMILES | CC[Si](CC)(CCCN(F)C(=O)Oc1cc(F)c(F)c(F)c1F)OC |
| InChI | InChI=1S/C15H20F5NO3Si/c1-4-25(5-2,23-3)8-6-7-21(20)15(22)24-11-9-10(16)12(17)14(19)13(11)18/h9H,4-8H2,1-3H3 |
| InChIKey | RFVVJLZQPSQKHU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|