C11H14F4OSi — CID 90172691
diethyl-methoxy-(2,3,4,5-tetrafluorophenyl)silane (PubChem CID 90172691) has the molecular formula C11H14F4OSi and a molecular weight of 266.31 g/mol. Its IUPAC name is diethyl-methoxy-(2,3,4,5-tetrafluorophenyl)silane.
| Compound Name | diethyl-methoxy-(2,3,4,5-tetrafluorophenyl)silane |
|---|---|
| PubChem CID | 90172691 |
| Molecular Formula | C11H14F4OSi |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | diethyl-methoxy-(2,3,4,5-tetrafluorophenyl)silane |
| SMILES | CC[Si](CC)(OC)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H14F4OSi/c1-4-17(5-2,16-3)8-6-7(12)9(13)11(15)10(8)14/h6H,4-5H2,1-3H3 |
| InChIKey | NSWRRFQEXSTLCD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|