C12H16F4O2Si — CID 90174355
diethoxy-methyl-[(2,3,4,5-tetrafluorophenyl)methyl]silane (PubChem CID 90174355) has the molecular formula C12H16F4O2Si and a molecular weight of 296.34 g/mol. Its IUPAC name is diethoxy-methyl-[(2,3,4,5-tetrafluorophenyl)methyl]silane.
| Compound Name | diethoxy-methyl-[(2,3,4,5-tetrafluorophenyl)methyl]silane |
|---|---|
| PubChem CID | 90174355 |
| Molecular Formula | C12H16F4O2Si |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | diethoxy-methyl-[(2,3,4,5-tetrafluorophenyl)methyl]silane |
| SMILES | CCO[Si](C)(Cc1cc(F)c(F)c(F)c1F)OCC |
| InChI | InChI=1S/C12H16F4O2Si/c1-4-17-19(3,18-5-2)7-8-6-9(13)11(15)12(16)10(8)14/h6H,4-5,7H2,1-3H3 |
| InChIKey | AUKJUUFBKNHDFF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|