C9H4F4O3 — CID 143785419
(2,3,4,5-tetrafluorophenyl) 2-oxopropanoate (PubChem CID 143785419) has the molecular formula C9H4F4O3 and a molecular weight of 236.12 g/mol. Its IUPAC name is (2,3,4,5-tetrafluorophenyl) 2-oxopropanoate.
| Compound Name | (2,3,4,5-tetrafluorophenyl) 2-oxopropanoate |
|---|---|
| PubChem CID | 143785419 |
| Molecular Formula | C9H4F4O3 |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (2,3,4,5-tetrafluorophenyl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)Oc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H4F4O3/c1-3(14)9(15)16-5-2-4(10)6(11)8(13)7(5)12/h2H,1H3 |
| InChIKey | SDUDUWGOSMWFRB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|