About (2-fluorophenyl) 2-oxopropanoate
(2-fluorophenyl) 2-oxopropanoate (PubChem CID 54044054) has the molecular formula C9H7FO3
and a molecular weight of 182.15 g/mol. Its IUPAC name is (2-fluorophenyl) 2-oxopropanoate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 2-oxopropanoate |
| PubChem CID | 54044054 |
| Molecular Formula | C9H7FO3 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | (2-fluorophenyl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)Oc1ccccc1F |
| InChI | InChI=1S/C9H7FO3/c1-6(11)9(12)13-8-5-3-2-4-7(8)10/h2-5H,1H3 |
| InChIKey | LOHRJPLQFLBYEW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 2-oxopropanoate?
The IUPAC name of (2-fluorophenyl) 2-oxopropanoate (CID 54044054) is (2-fluorophenyl) 2-oxopropanoate.
What is the SMILES notation for (2-fluorophenyl) 2-oxopropanoate?
The canonical SMILES for (2-fluorophenyl) 2-oxopropanoate is CC(=O)C(=O)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) 2-oxopropanoate?
The InChIKey is LOHRJPLQFLBYEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO3/c1-6(11)9(12)13-8-5-3-2-4-7(8)10/h2-5H,1H3.
What are the key properties of (2-fluorophenyl) 2-oxopropanoate?
(2-fluorophenyl) 2-oxopropanoate has a molecular weight of 182.15 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 2-oxopropanoate is sourced from PubChem (CID 54044054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).