About (2-fluorophenyl) N-ethyl-N-methylcarbamate
(2-fluorophenyl) N-ethyl-N-methylcarbamate (PubChem CID 171662509) has the molecular formula C10H12FNO2
and a molecular weight of 197.21 g/mol. Its IUPAC name is (2-fluorophenyl) N-ethyl-N-methylcarbamate.
Molecular Properties
| Compound Name | (2-fluorophenyl) N-ethyl-N-methylcarbamate |
| PubChem CID | 171662509 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2-fluorophenyl) N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)Oc1ccccc1F |
| InChI | InChI=1S/C10H12FNO2/c1-3-12(2)10(13)14-9-7-5-4-6-8(9)11/h4-7H,3H2,1-2H3 |
| InChIKey | DWGCWBOZPQAZJX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-fluorophenyl) N-ethyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) N-ethyl-N-methylcarbamate?
The IUPAC name of (2-fluorophenyl) N-ethyl-N-methylcarbamate (CID 171662509) is (2-fluorophenyl) N-ethyl-N-methylcarbamate.
What is the SMILES notation for (2-fluorophenyl) N-ethyl-N-methylcarbamate?
The canonical SMILES for (2-fluorophenyl) N-ethyl-N-methylcarbamate is CCN(C)C(=O)Oc1ccccc1F.
What is the InChIKey of (2-fluorophenyl) N-ethyl-N-methylcarbamate?
The InChIKey is DWGCWBOZPQAZJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO2/c1-3-12(2)10(13)14-9-7-5-4-6-8(9)11/h4-7H,3H2,1-2H3.
What are the key properties of (2-fluorophenyl) N-ethyl-N-methylcarbamate?
(2-fluorophenyl) N-ethyl-N-methylcarbamate has a molecular weight of 197.21 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) N-ethyl-N-methylcarbamate is sourced from PubChem (CID 171662509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).