C13H13F4NO3 — CID 61007496
methyl 3-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]propanoate (PubChem CID 61007496) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is methyl 3-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]propanoate.
| Compound Name | methyl 3-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 61007496 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | methyl 3-[ethyl-(2,3,4,5-tetrafluorobenzoyl)amino]propanoate |
| SMILES | CCN(CCC(=O)OC)C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H13F4NO3/c1-3-18(5-4-9(19)21-2)13(20)7-6-8(14)11(16)12(17)10(7)15/h6H,3-5H2,1-2H3 |
| InChIKey | DSWSZSYMDJOTNJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|