C15H21NO5 — CID 61007489
methyl 3-[(3,5-dimethoxybenzoyl)-ethylamino]propanoate (PubChem CID 61007489) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 3-[(3,5-dimethoxybenzoyl)-ethylamino]propanoate.
| Compound Name | methyl 3-[(3,5-dimethoxybenzoyl)-ethylamino]propanoate |
|---|---|
| PubChem CID | 61007489 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl 3-[(3,5-dimethoxybenzoyl)-ethylamino]propanoate |
| SMILES | CCN(CCC(=O)OC)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C15H21NO5/c1-5-16(7-6-14(17)21-4)15(18)11-8-12(19-2)10-13(9-11)20-3/h8-10H,5-7H2,1-4H3 |
| InChIKey | RYRDAUILDTVWKB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |