C12H15FN2O3 — CID 103633415
methyl 3-[ethyl-(2-fluoropyridine-4-carbonyl)amino]propanoate (PubChem CID 103633415) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is methyl 3-[ethyl-(2-fluoropyridine-4-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[ethyl-(2-fluoropyridine-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103633415 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl 3-[ethyl-(2-fluoropyridine-4-carbonyl)amino]propanoate |
| SMILES | CCN(CCC(=O)OC)C(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C12H15FN2O3/c1-3-15(7-5-11(16)18-2)12(17)9-4-6-14-10(13)8-9/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | KAYDXGABWSHVGB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|