C14H19BrN2O3 — CID 103752528
methyl 3-[(2-bromopyridine-4-carbonyl)-(2-methylpropyl)amino]propanoate (PubChem CID 103752528) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is methyl 3-[(2-bromopyridine-4-carbonyl)-(2-methylpropyl)amino]propanoate.
| Compound Name | methyl 3-[(2-bromopyridine-4-carbonyl)-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 103752528 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | methyl 3-[(2-bromopyridine-4-carbonyl)-(2-methylpropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CC(C)C)C(=O)c1ccnc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-10(2)9-17(7-5-13(18)20-3)14(19)11-4-6-16-12(15)8-11/h4,6,8,10H,5,7,9H2,1-3H3 |
| InChIKey | TTZBYAGNRGGJTK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|