C13H18ClN3O3 — CID 103337286
methyl 3-[(6-chloropyrazine-2-carbonyl)-(2-methylpropyl)amino]propanoate (PubChem CID 103337286) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is methyl 3-[(6-chloropyrazine-2-carbonyl)-(2-methylpropyl)amino]propanoate.
| Compound Name | methyl 3-[(6-chloropyrazine-2-carbonyl)-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 103337286 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | methyl 3-[(6-chloropyrazine-2-carbonyl)-(2-methylpropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CC(C)C)C(=O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C13H18ClN3O3/c1-9(2)8-17(5-4-12(18)20-3)13(19)10-6-15-7-11(14)16-10/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | QAVGHSWRWKTYMP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |