About 6-chloro-N,N-dipropylpyrazine-2-carboxamide
6-chloro-N,N-dipropylpyrazine-2-carboxamide (PubChem CID 103186958) has the molecular formula C11H16ClN3O
and a molecular weight of 241.72 g/mol. Its IUPAC name is 6-chloro-N,N-dipropylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-N,N-dipropylpyrazine-2-carboxamide |
| PubChem CID | 103186958 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 6-chloro-N,N-dipropylpyrazine-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C11H16ClN3O/c1-3-5-15(6-4-2)11(16)9-7-13-8-10(12)14-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | NTUIWKPIDRZIMX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-N,N-dipropylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,N-dipropylpyrazine-2-carboxamide?
The IUPAC name of 6-chloro-N,N-dipropylpyrazine-2-carboxamide (CID 103186958) is 6-chloro-N,N-dipropylpyrazine-2-carboxamide.
What is the SMILES notation for 6-chloro-N,N-dipropylpyrazine-2-carboxamide?
The canonical SMILES for 6-chloro-N,N-dipropylpyrazine-2-carboxamide is CCCN(CCC)C(=O)c1cncc(Cl)n1.
What is the InChIKey of 6-chloro-N,N-dipropylpyrazine-2-carboxamide?
The InChIKey is NTUIWKPIDRZIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClN3O/c1-3-5-15(6-4-2)11(16)9-7-13-8-10(12)14-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 6-chloro-N,N-dipropylpyrazine-2-carboxamide?
6-chloro-N,N-dipropylpyrazine-2-carboxamide has a molecular weight of 241.72 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,N-dipropylpyrazine-2-carboxamide is sourced from PubChem (CID 103186958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).