C11H15N3O3 — CID 54899038
methyl 3-[ethyl(pyrazine-2-carbonyl)amino]propanoate (PubChem CID 54899038) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is methyl 3-[ethyl(pyrazine-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[ethyl(pyrazine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 54899038 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | methyl 3-[ethyl(pyrazine-2-carbonyl)amino]propanoate |
| SMILES | CCN(CCC(=O)OC)C(=O)c1cnccn1 |
| InChI | InChI=1S/C11H15N3O3/c1-3-14(7-4-10(15)17-2)11(16)9-8-12-5-6-13-9/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | AYZMKBDZPZTPTH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |