C16H26N4O3 — CID 42783356
N-(2-methoxyethyl)-N-[3-(3-methylbutan-2-ylamino)-3-oxopropyl]pyrazine-2-carboxamide (PubChem CID 42783356) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[3-(3-methylbutan-2-ylamino)-3-oxopropyl]pyrazine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-[3-(3-methylbutan-2-ylamino)-3-oxopropyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 42783356 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-(2-methoxyethyl)-N-[3-(3-methylbutan-2-ylamino)-3-oxopropyl]pyrazine-2-carboxamide |
| SMILES | COCCN(CCC(=O)NC(C)C(C)C)C(=O)c1cnccn1 |
| InChI | InChI=1S/C16H26N4O3/c1-12(2)13(3)19-15(21)5-8-20(9-10-23-4)16(22)14-11-17-6-7-18-14/h6-7,11-13H,5,8-10H2,1-4H3,(H,19,21) |
| InChIKey | JHCBALINRNADTN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |