C20H24N4O5 — CID 3558029
N-[3-(1,3-benzodioxol-5-ylmethylamino)-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide (PubChem CID 3558029) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylmethylamino)-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylmethylamino)-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 3558029 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylmethylamino)-3-oxopropyl]-N-(3-methoxypropyl)pyrazine-2-carboxamide |
| SMILES | COCCCN(CCC(=O)NCc1ccc2c(c1)OCO2)C(=O)c1cnccn1 |
| InChI | InChI=1S/C20H24N4O5/c1-27-10-2-8-24(20(26)16-13-21-6-7-22-16)9-5-19(25)23-12-15-3-4-17-18(11-15)29-14-28-17/h3-4,6-7,11,13H,2,5,8-10,12,14H2,1H3,(H,23,25) |
| InChIKey | RYUVCCUFPZTNDQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|